C14H26N2 — CID 143159768
N-[(4E,6Z)-4-ethylnona-4,6-dien-2-yl]-N,N'-dimethylmethanimidamide (PubChem CID 143159768) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-[(4E,6Z)-4-ethylnona-4,6-dien-2-yl]-N,N'-dimethylmethanimidamide.
| Compound Name | N-[(4E,6Z)-4-ethylnona-4,6-dien-2-yl]-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 143159768 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-[(4E,6Z)-4-ethylnona-4,6-dien-2-yl]-N,N'-dimethylmethanimidamide |
| SMILES | CC/C=C\C=C(/CC)CC(C)N(C)/C=N/C |
| InChI | InChI=1S/C14H26N2/c1-6-8-9-10-14(7-2)11-13(3)16(5)12-15-4/h8-10,12-13H,6-7,11H2,1-5H3/b9-8-,14-10+,15-12+ |
| InChIKey | LFKZIYUPPQFMFE-USWWLJMGSA-N |
| XLogP | 3.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|