C14H20N2 — CID 122608717
1-cyclohexyl-6-methyl-3a,7a-dihydrobenzimidazole (PubChem CID 122608717) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-cyclohexyl-6-methyl-3a,7a-dihydrobenzimidazole.
| Compound Name | 1-cyclohexyl-6-methyl-3a,7a-dihydrobenzimidazole |
|---|---|
| PubChem CID | 122608717 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-cyclohexyl-6-methyl-3a,7a-dihydrobenzimidazole |
| SMILES | CC1=CC2C(C=C1)N=CN2C1CCCCC1 |
| InChI | InChI=1S/C14H20N2/c1-11-7-8-13-14(9-11)16(10-15-13)12-5-3-2-4-6-12/h7-10,12-14H,2-6H2,1H3 |
| InChIKey | HSRMMIXLOCHMIL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |