C12H17NO2S2 — CID 110760869
N-propan-2-yl-3,4-dihydro-2H-thiochromene-6-sulfonamide (PubChem CID 110760869) has the molecular formula C12H17NO2S2 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-propan-2-yl-3,4-dihydro-2H-thiochromene-6-sulfonamide.
| Compound Name | N-propan-2-yl-3,4-dihydro-2H-thiochromene-6-sulfonamide |
|---|---|
| PubChem CID | 110760869 |
| Molecular Formula | C12H17NO2S2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-propan-2-yl-3,4-dihydro-2H-thiochromene-6-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H17NO2S2/c1-9(2)13-17(14,15)11-5-6-12-10(8-11)4-3-7-16-12/h5-6,8-9,13H,3-4,7H2,1-2H3 |
| InChIKey | FVDYWGWZHFSMLL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |