C17H19ClN2O2 — CID 110762978
5-chloro-2-methoxy-N,3-dimethyl-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 110762978) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N,3-dimethyl-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 5-chloro-2-methoxy-N,3-dimethyl-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 110762978 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-chloro-2-methoxy-N,3-dimethyl-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | COc1c(C)cc(Cl)cc1C(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-12-10-14(18)11-15(16(12)22-3)17(21)20(2)9-6-13-4-7-19-8-5-13/h4-5,7-8,10-11H,6,9H2,1-3H3 |
| InChIKey | BGZCLGOYXVFFQZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |