C16H11N3O2 — CID 110765337
N-(3-cyanophenyl)-2-methyl-1,3-benzoxazole-6-carboxamide (PubChem CID 110765337) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-methyl-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(3-cyanophenyl)-2-methyl-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110765337 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(3-cyanophenyl)-2-methyl-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3cccc(C#N)c3)cc2o1 |
| InChI | InChI=1S/C16H11N3O2/c1-10-18-14-6-5-12(8-15(14)21-10)16(20)19-13-4-2-3-11(7-13)9-17/h2-8H,1H3,(H,19,20) |
| InChIKey | QZFIQXFURHNBTR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |