C21H21N3O2 — CID 110768453
N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide (PubChem CID 110768453) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 110768453 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CCC(=O)N2)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21N3O2/c25-20-8-6-15-11-14(5-7-18(15)24-20)12-21(26)22-10-9-16-13-23-19-4-2-1-3-17(16)19/h1-5,7,11,13,23H,6,8-10,12H2,(H,22,26)(H,24,25) |
| InChIKey | UNGXFFZGGRROFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |