C19H28N2O3 — CID 110769578
4-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)acetyl]piperazine-1-carbaldehyde (PubChem CID 110769578) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 4-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)acetyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)acetyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110769578 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-[2-(3-tert-butyl-2-methoxy-5-methylphenyl)acetyl]piperazine-1-carbaldehyde |
| SMILES | COc1c(CC(=O)N2CCN(C=O)CC2)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C19H28N2O3/c1-14-10-15(18(24-5)16(11-14)19(2,3)4)12-17(23)21-8-6-20(13-22)7-9-21/h10-11,13H,6-9,12H2,1-5H3 |
| InChIKey | HYPGYQVCZLRTJG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|