About [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate
[(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate (PubChem CID 11077012) has the molecular formula C14H22O2S2
and a molecular weight of 286.46 g/mol. Its IUPAC name is [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate.
Molecular Properties
| Compound Name | [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate |
| PubChem CID | 11077012 |
| Molecular Formula | C14H22O2S2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate |
| SMILES | C=CCCCC1(CC(=O)O[C@H](C)C=C)SCCS1 |
| InChI | InChI=1S/C14H22O2S2/c1-4-6-7-8-14(17-9-10-18-14)11-13(15)16-12(3)5-2/h4-5,12H,1-2,6-11H2,3H3/t12-/m1/s1 |
| InChIKey | BMURDUPPALJANC-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate?
The IUPAC name of [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate (CID 11077012) is [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate.
What is the SMILES notation for [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate?
The canonical SMILES for [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate is C=CCCCC1(CC(=O)O[C@H](C)C=C)SCCS1.
What is the InChIKey of [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate?
The InChIKey is BMURDUPPALJANC-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H22O2S2/c1-4-6-7-8-14(17-9-10-18-14)11-13(15)16-12(3)5-2/h4-5,12H,1-2,6-11H2,3H3/t12-/m1/s1.
What are the key properties of [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate?
[(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate has a molecular weight of 286.46 g/mol, XLogP of 4.03, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-but-3-en-2-yl] 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetate is sourced from PubChem (CID 11077012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).