C17H15ClN2O4 — CID 110771892
2-(1,3-benzoxazol-6-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide (PubChem CID 110771892) has the molecular formula C17H15ClN2O4 and a molecular weight of 346.77 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110771892 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)Cc2ccc3ncoc3c2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H15ClN2O4/c1-22-14-8-13(15(23-2)7-11(14)18)20-17(21)6-10-3-4-12-16(5-10)24-9-19-12/h3-5,7-9H,6H2,1-2H3,(H,20,21) |
| InChIKey | ALKCWKGGSBGVFY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |