C16H13ClN2O4 — CID 110765168
N-(4-chloro-2,5-dimethoxyphenyl)-1,3-benzoxazole-6-carboxamide (PubChem CID 110765168) has the molecular formula C16H13ClN2O4 and a molecular weight of 332.74 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110765168 |
| Molecular Formula | C16H13ClN2O4 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-1,3-benzoxazole-6-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3ncoc3c2)c(OC)cc1Cl |
| InChI | InChI=1S/C16H13ClN2O4/c1-21-13-7-12(14(22-2)6-10(13)17)19-16(20)9-3-4-11-15(5-9)23-8-18-11/h3-8H,1-2H3,(H,19,20) |
| InChIKey | RLJNZNNRTQJZIP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |