C16H20FNO3 — CID 11077220
(3S,3aR,7S,7aR)-1-benzyl-7-ethyl-7-fluoro-3-methyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one (PubChem CID 11077220) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is (3S,3aR,7S,7aR)-1-benzyl-7-ethyl-7-fluoro-3-methyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one.
| Compound Name | (3S,3aR,7S,7aR)-1-benzyl-7-ethyl-7-fluoro-3-methyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 11077220 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3S,3aR,7S,7aR)-1-benzyl-7-ethyl-7-fluoro-3-methyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one |
| SMILES | CC[C@@]1(F)COC(=O)[C@H]2[C@H](C)ON(Cc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C16H20FNO3/c1-3-16(17)10-20-15(19)13-11(2)21-18(14(13)16)9-12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10H2,1-2H3/t11-,13-,14+,16+/m0/s1 |
| InChIKey | NNIUHESMLYMOEZ-YYWXWVFPSA-N |
| XLogP | 2.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |