C15H18FNO3 — CID 15199276
(3S,3aR,7S,7aR)-1-benzyl-7-fluoro-3,7-dimethyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one (PubChem CID 15199276) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is (3S,3aR,7S,7aR)-1-benzyl-7-fluoro-3,7-dimethyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one.
| Compound Name | (3S,3aR,7S,7aR)-1-benzyl-7-fluoro-3,7-dimethyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 15199276 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (3S,3aR,7S,7aR)-1-benzyl-7-fluoro-3,7-dimethyl-3,3a,6,7a-tetrahydropyrano[4,3-c][1,2]oxazol-4-one |
| SMILES | C[C@@H]1ON(Cc2ccccc2)[C@@H]2[C@H]1C(=O)OC[C@@]2(C)F |
| InChI | InChI=1S/C15H18FNO3/c1-10-12-13(15(2,16)9-19-14(12)18)17(20-10)8-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t10-,12-,13+,15+/m0/s1 |
| InChIKey | AGKCRHDHYCABSG-MUYACECFSA-N |
| XLogP | 2.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |