C14H19N3O3 — CID 110775237
1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-propan-2-ylurea (PubChem CID 110775237) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-propan-2-ylurea.
| Compound Name | 1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 110775237 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-[(2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCc1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C14H19N3O3/c1-8(2)16-14(19)15-7-10-4-5-12-11(6-10)17-13(18)9(3)20-12/h4-6,8-9H,7H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | XWPMMIAEPUGAQX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |