C14H20N4O2 — CID 110775432
1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-3-propylurea (PubChem CID 110775432) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-3-propylurea.
| Compound Name | 1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-3-propylurea |
|---|---|
| PubChem CID | 110775432 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methyl]-3-propylurea |
| SMILES | CCCNC(=O)NCc1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H20N4O2/c1-4-7-15-13(19)16-9-10-5-6-11-12(8-10)18(3)14(20)17(11)2/h5-6,8H,4,7,9H2,1-3H3,(H2,15,16,19) |
| InChIKey | RUBUGHNZBXJWEA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |