C15H23FN2O2 — CID 110775671
1-(2,2-dimethylpropyl)-3-[2-(3-fluoro-4-methoxyphenyl)ethyl]urea (PubChem CID 110775671) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[2-(3-fluoro-4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[2-(3-fluoro-4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 110775671 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[2-(3-fluoro-4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NCC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H23FN2O2/c1-15(2,3)10-18-14(19)17-8-7-11-5-6-13(20-4)12(16)9-11/h5-6,9H,7-8,10H2,1-4H3,(H2,17,18,19) |
| InChIKey | MWSJIAJMLGGBJM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |