C16H16N2O4S — CID 110777916
2-cyano-N-(2,4-dimethoxy-3-methylphenyl)benzenesulfonamide (PubChem CID 110777916) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dimethoxy-3-methylphenyl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(2,4-dimethoxy-3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110777916 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-cyano-N-(2,4-dimethoxy-3-methylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccccc2C#N)c(OC)c1C |
| InChI | InChI=1S/C16H16N2O4S/c1-11-14(21-2)9-8-13(16(11)22-3)18-23(19,20)15-7-5-4-6-12(15)10-17/h4-9,18H,1-3H3 |
| InChIKey | QCVVSCOJBLCVRG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |