C16H16N2O3S — CID 110776899
2-cyano-N-(4-methoxy-2,5-dimethylphenyl)benzenesulfonamide (PubChem CID 110776899) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-cyano-N-(4-methoxy-2,5-dimethylphenyl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(4-methoxy-2,5-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110776899 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-cyano-N-(4-methoxy-2,5-dimethylphenyl)benzenesulfonamide |
| SMILES | COc1cc(C)c(NS(=O)(=O)c2ccccc2C#N)cc1C |
| InChI | InChI=1S/C16H16N2O3S/c1-11-9-15(21-3)12(2)8-14(11)18-22(19,20)16-7-5-4-6-13(16)10-17/h4-9,18H,1-3H3 |
| InChIKey | RYXGZMIZMDNECB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |