C16H34O3SSi — CID 11078175
S-ethyl (3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoctanethioate (PubChem CID 11078175) has the molecular formula C16H34O3SSi and a molecular weight of 334.60 g/mol. Its IUPAC name is S-ethyl (3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoctanethioate.
| Compound Name | S-ethyl (3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoctanethioate |
|---|---|
| PubChem CID | 11078175 |
| Molecular Formula | C16H34O3SSi |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | S-ethyl (3S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoctanethioate |
| SMILES | CCSC(=O)C[C@@H](O)CCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3SSi/c1-8-20-15(18)12-14(17)11-9-10-13(2)19-21(6,7)16(3,4)5/h13-14,17H,8-12H2,1-7H3/t13-,14+/m1/s1 |
| InChIKey | SEXSTBGGJORQIT-KGLIPLIRSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|