C20H42O3SSi — CID 11047431
S-tert-butyl (2S,3S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylnonanethioate (PubChem CID 11047431) has the molecular formula C20H42O3SSi and a molecular weight of 390.71 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylnonanethioate.
| Compound Name | S-tert-butyl (2S,3S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylnonanethioate |
|---|---|
| PubChem CID | 11047431 |
| Molecular Formula | C20H42O3SSi |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | S-tert-butyl (2S,3S)-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylnonanethioate |
| SMILES | C[C@H](C(=O)SC(C)(C)C)[C@@H](O)CCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O3SSi/c1-16(18(22)24-19(2,3)4)17(21)14-12-10-11-13-15-23-25(8,9)20(5,6)7/h16-17,21H,10-15H2,1-9H3/t16-,17-/m0/s1 |
| InChIKey | HTUCKFCTGBLIRP-IRXDYDNUSA-N |
| XLogP | 6.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|