C26H56O3SSi2 — CID 11103159
S-tert-butyl (2S,3S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylnonanethioate (PubChem CID 11103159) has the molecular formula C26H56O3SSi2 and a molecular weight of 504.97 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylnonanethioate.
| Compound Name | S-tert-butyl (2S,3S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylnonanethioate |
|---|---|
| PubChem CID | 11103159 |
| Molecular Formula | C26H56O3SSi2 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | S-tert-butyl (2S,3S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylnonanethioate |
| SMILES | C[C@H](C(=O)SC(C)(C)C)[C@H](CCCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O3SSi2/c1-21(23(27)30-24(2,3)4)22(29-32(13,14)26(8,9)10)19-17-15-16-18-20-28-31(11,12)25(5,6)7/h21-22H,15-20H2,1-14H3/t21-,22-/m0/s1 |
| InChIKey | RWWABWMRMMFLOB-VXKWHMMOSA-N |
| XLogP | 9.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|