C19H28O5 — CID 11078218
methyl (3aS,7aS)-2-[4-(oxan-2-yloxy)butyl]-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate (PubChem CID 11078218) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is methyl (3aS,7aS)-2-[4-(oxan-2-yloxy)butyl]-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate.
| Compound Name | methyl (3aS,7aS)-2-[4-(oxan-2-yloxy)butyl]-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 11078218 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | methyl (3aS,7aS)-2-[4-(oxan-2-yloxy)butyl]-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)C1=C(CCCCOC2CCCCO2)O[C@H]2C=CCC[C@@H]12 |
| InChI | InChI=1S/C19H28O5/c1-21-19(20)18-14-8-2-3-9-15(14)24-16(18)10-4-6-12-22-17-11-5-7-13-23-17/h3,9,14-15,17H,2,4-8,10-13H2,1H3/t14-,15+,17?/m1/s1 |
| InChIKey | HYIWMBHRJPMNCK-CKDQBVIESA-N |
| XLogP | 3.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|