C12H16N2O4S — CID 110783601
N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]ethanesulfonamide (PubChem CID 110783601) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]ethanesulfonamide.
| Compound Name | N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110783601 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[(4-methyl-3-oxo-1,4-benzoxazin-6-yl)methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C12H16N2O4S/c1-3-19(16,17)13-7-9-4-5-11-10(6-9)14(2)12(15)8-18-11/h4-6,13H,3,7-8H2,1-2H3 |
| InChIKey | IDNVGHKLBONKCK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |