C17H24N2O2 — CID 110784021
N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)methyl]-3,3-dimethylbutanamide (PubChem CID 110784021) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)methyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)methyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 110784021 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[(3,3-dimethyl-2-oxo-1H-indol-5-yl)methyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCc1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C17H24N2O2/c1-16(2,3)9-14(20)18-10-11-6-7-13-12(8-11)17(4,5)15(21)19-13/h6-8H,9-10H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | PDVWLBSTQYEQHM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |