C22H34N2O — CID 11078403
(1R,2S,4S,6S,7S,10S,11R,14S)-6-ethanehydrazonoyl-7,11-dimethylpentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-ol (PubChem CID 11078403) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (1R,2S,4S,6S,7S,10S,11R,14S)-6-ethanehydrazonoyl-7,11-dimethylpentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-ol.
| Compound Name | (1R,2S,4S,6S,7S,10S,11R,14S)-6-ethanehydrazonoyl-7,11-dimethylpentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-ol |
|---|---|
| PubChem CID | 11078403 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (1R,2S,4S,6S,7S,10S,11R,14S)-6-ethanehydrazonoyl-7,11-dimethylpentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-ol |
| SMILES | C/C(=N/N)[C@@]12C[C@@H]1C[C@H]1[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C22H34N2O/c1-13(24-23)22-12-15(22)11-19-17-5-4-14-10-16(25)6-8-20(14,2)18(17)7-9-21(19,22)3/h4,15-19,25H,5-12,23H2,1-3H3/b24-13-/t15-,16-,17+,18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | RVCFIUWMSIVTMK-YBUNGHNGSA-N |
| XLogP | 4.26 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|