C25H36O2 — CID 171979172
1-[(4aR,6aS,10aS)-2-hydroxy-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,10,10a,11,11a,11b,12-tetradecahydroindeno[2,1-a]phenanthren-6b-yl]ethanone (PubChem CID 171979172) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1-[(4aR,6aS,10aS)-2-hydroxy-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,10,10a,11,11a,11b,12-tetradecahydroindeno[2,1-a]phenanthren-6b-yl]ethanone.
| Compound Name | 1-[(4aR,6aS,10aS)-2-hydroxy-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,10,10a,11,11a,11b,12-tetradecahydroindeno[2,1-a]phenanthren-6b-yl]ethanone |
|---|---|
| PubChem CID | 171979172 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 1-[(4aR,6aS,10aS)-2-hydroxy-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,10,10a,11,11a,11b,12-tetradecahydroindeno[2,1-a]phenanthren-6b-yl]ethanone |
| SMILES | CC(=O)C12CC=CC[C@H]1CC1C3CC=C4CC(O)CC[C@]4(C)C3CC[C@@]12C |
| InChI | InChI=1S/C25H36O2/c1-16(26)25-11-5-4-6-18(25)15-22-20-8-7-17-14-19(27)9-12-23(17,2)21(20)10-13-24(22,25)3/h4-5,7,18-22,27H,6,8-15H2,1-3H3/t18-,19?,20?,21?,22?,23-,24-,25?/m0/s1 |
| InChIKey | HVHYRVHDTSSVNF-KNLYRDEVSA-N |
| XLogP | 5.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|