C14H15ClN2OS — CID 110784452
N-[(4-methylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride (PubChem CID 110784452) has the molecular formula C14H15ClN2OS and a molecular weight of 294.81 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride.
| Compound Name | N-[(4-methylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 110784452 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride |
| SMILES | CSc1ccc(CNC(=O)c2ccncc2)cc1.Cl |
| InChI | InChI=1S/C14H14N2OS.ClH/c1-18-13-4-2-11(3-5-13)10-16-14(17)12-6-8-15-9-7-12;/h2-9H,10H2,1H3,(H,16,17);1H |
| InChIKey | XDPCJCZFUFOIAT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |