C16H19ClN2OS — CID 110784665
N-[(4-propan-2-ylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride (PubChem CID 110784665) has the molecular formula C16H19ClN2OS and a molecular weight of 322.86 g/mol. Its IUPAC name is N-[(4-propan-2-ylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride.
| Compound Name | N-[(4-propan-2-ylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 110784665 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[(4-propan-2-ylsulfanylphenyl)methyl]pyridine-4-carboxamide;hydrochloride |
| SMILES | CC(C)Sc1ccc(CNC(=O)c2ccncc2)cc1.Cl |
| InChI | InChI=1S/C16H18N2OS.ClH/c1-12(2)20-15-5-3-13(4-6-15)11-18-16(19)14-7-9-17-10-8-14;/h3-10,12H,11H2,1-2H3,(H,18,19);1H |
| InChIKey | VHSPOHVZIGTINR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |