C16H21N3O3 — CID 110785722
methyl 4-oxo-4-[(2-propan-2-yl-3H-benzimidazol-5-yl)methylamino]butanoate (PubChem CID 110785722) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 4-oxo-4-[(2-propan-2-yl-3H-benzimidazol-5-yl)methylamino]butanoate.
| Compound Name | methyl 4-oxo-4-[(2-propan-2-yl-3H-benzimidazol-5-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 110785722 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | methyl 4-oxo-4-[(2-propan-2-yl-3H-benzimidazol-5-yl)methylamino]butanoate |
| SMILES | COC(=O)CCC(=O)NCc1ccc2nc(C(C)C)[nH]c2c1 |
| InChI | InChI=1S/C16H21N3O3/c1-10(2)16-18-12-5-4-11(8-13(12)19-16)9-17-14(20)6-7-15(21)22-3/h4-5,8,10H,6-7,9H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | QYWPTVUNGRICDK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |