C12H17N3O2S — CID 110785750
N-[(2-propan-2-yl-3H-benzimidazol-5-yl)methyl]methanesulfonamide (PubChem CID 110785750) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(2-propan-2-yl-3H-benzimidazol-5-yl)methyl]methanesulfonamide.
| Compound Name | N-[(2-propan-2-yl-3H-benzimidazol-5-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 110785750 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[(2-propan-2-yl-3H-benzimidazol-5-yl)methyl]methanesulfonamide |
| SMILES | CC(C)c1nc2ccc(CNS(C)(=O)=O)cc2[nH]1 |
| InChI | InChI=1S/C12H17N3O2S/c1-8(2)12-14-10-5-4-9(6-11(10)15-12)7-13-18(3,16)17/h4-6,8,13H,7H2,1-3H3,(H,14,15) |
| InChIKey | ILRMWSMZXFFFIX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |