C16H23N3O — CID 110785953
N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-2-ethylbutanamide (PubChem CID 110785953) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-2-ethylbutanamide.
| Compound Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 110785953 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCc1ccc2c(c1)nc(C)n2C |
| InChI | InChI=1S/C16H23N3O/c1-5-13(6-2)16(20)17-10-12-7-8-15-14(9-12)18-11(3)19(15)4/h7-9,13H,5-6,10H2,1-4H3,(H,17,20) |
| InChIKey | ISXUAVDTMLYUAF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |