C17H16FN3O — CID 110785961
N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-3-fluorobenzamide (PubChem CID 110785961) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-3-fluorobenzamide.
| Compound Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 110785961 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-3-fluorobenzamide |
| SMILES | Cc1nc2cc(CNC(=O)c3cccc(F)c3)ccc2n1C |
| InChI | InChI=1S/C17H16FN3O/c1-11-20-15-8-12(6-7-16(15)21(11)2)10-19-17(22)13-4-3-5-14(18)9-13/h3-9H,10H2,1-2H3,(H,19,22) |
| InChIKey | TYZSLBZCWDHJFS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |