C20H30O5 — CID 11078629
(10Z)-10-(methoxymethylidene)-8,8-dimethyl-1,2-di(propan-2-yloxy)spiro[4.5]dec-1-ene-3,4-dione (PubChem CID 11078629) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (10Z)-10-(methoxymethylidene)-8,8-dimethyl-1,2-di(propan-2-yloxy)spiro[4.5]dec-1-ene-3,4-dione.
| Compound Name | (10Z)-10-(methoxymethylidene)-8,8-dimethyl-1,2-di(propan-2-yloxy)spiro[4.5]dec-1-ene-3,4-dione |
|---|---|
| PubChem CID | 11078629 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (10Z)-10-(methoxymethylidene)-8,8-dimethyl-1,2-di(propan-2-yloxy)spiro[4.5]dec-1-ene-3,4-dione |
| SMILES | CO/C=C1/CC(C)(C)CCC12C(=O)C(=O)C(OC(C)C)=C2OC(C)C |
| InChI | InChI=1S/C20H30O5/c1-12(2)24-16-15(21)17(22)20(18(16)25-13(3)4)9-8-19(5,6)10-14(20)11-23-7/h11-13H,8-10H2,1-7H3/b14-11- |
| InChIKey | WETPUCRRNGWJPZ-KAMYIIQDSA-N |
| XLogP | 3.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|