C17H26O3 — CID 10540581
(3aS,6aR)-3a,6a-dimethyl-4-methylidene-2,3-di(propan-2-yloxy)-5,6-dihydropentalen-1-one (PubChem CID 10540581) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3aS,6aR)-3a,6a-dimethyl-4-methylidene-2,3-di(propan-2-yloxy)-5,6-dihydropentalen-1-one.
| Compound Name | (3aS,6aR)-3a,6a-dimethyl-4-methylidene-2,3-di(propan-2-yloxy)-5,6-dihydropentalen-1-one |
|---|---|
| PubChem CID | 10540581 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3aS,6aR)-3a,6a-dimethyl-4-methylidene-2,3-di(propan-2-yloxy)-5,6-dihydropentalen-1-one |
| SMILES | C=C1CC[C@@]2(C)C(=O)C(OC(C)C)=C(OC(C)C)[C@@]12C |
| InChI | InChI=1S/C17H26O3/c1-10(2)19-13-14(18)16(6)9-8-12(5)17(16,7)15(13)20-11(3)4/h10-11H,5,8-9H2,1-4,6-7H3/t16-,17+/m0/s1 |
| InChIKey | DWXKXNNFRAFWFU-DLBZAZTESA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|