C16H24O3 — CID 95565599
(3aR,6aS)-3a-methyl-6-methylidene-2,3-di(propan-2-yloxy)-5,6a-dihydro-4H-pentalen-1-one (PubChem CID 95565599) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3aR,6aS)-3a-methyl-6-methylidene-2,3-di(propan-2-yloxy)-5,6a-dihydro-4H-pentalen-1-one.
| Compound Name | (3aR,6aS)-3a-methyl-6-methylidene-2,3-di(propan-2-yloxy)-5,6a-dihydro-4H-pentalen-1-one |
|---|---|
| PubChem CID | 95565599 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3aR,6aS)-3a-methyl-6-methylidene-2,3-di(propan-2-yloxy)-5,6a-dihydro-4H-pentalen-1-one |
| SMILES | C=C1CC[C@@]2(C)C(OC(C)C)=C(OC(C)C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H24O3/c1-9(2)18-14-13(17)12-11(5)7-8-16(12,6)15(14)19-10(3)4/h9-10,12H,5,7-8H2,1-4,6H3/t12-,16-/m1/s1 |
| InChIKey | YJOSWXMHOVHTCI-MLGOLLRUSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|