C20H28O5 — CID 10315733
2-[2-[(E)-2-methoxyprop-1-enyl]cyclopenten-1-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione (PubChem CID 10315733) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[2-[(E)-2-methoxyprop-1-enyl]cyclopenten-1-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione.
| Compound Name | 2-[2-[(E)-2-methoxyprop-1-enyl]cyclopenten-1-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 10315733 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[2-[(E)-2-methoxyprop-1-enyl]cyclopenten-1-yl]-4,5-di(propan-2-yloxy)cyclopent-4-ene-1,3-dione |
| SMILES | CO/C(C)=C/C1=C(C2C(=O)C(OC(C)C)=C(OC(C)C)C2=O)CCC1 |
| InChI | InChI=1S/C20H28O5/c1-11(2)24-19-17(21)16(18(22)20(19)25-12(3)4)15-9-7-8-14(15)10-13(5)23-6/h10-12,16H,7-9H2,1-6H3/b13-10+ |
| InChIKey | UOYDJMPNCXMZRN-JLHYYAGUSA-N |
| XLogP | 3.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|