C21H32O4 — CID 137473684
4-methyl-2-[(4S)-2-(3-methylbutanoyl)-4-(3-methylbut-2-enyl)-3-oxocyclopenten-1-yl]oxypentanal (PubChem CID 137473684) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 4-methyl-2-[(4S)-2-(3-methylbutanoyl)-4-(3-methylbut-2-enyl)-3-oxocyclopenten-1-yl]oxypentanal.
| Compound Name | 4-methyl-2-[(4S)-2-(3-methylbutanoyl)-4-(3-methylbut-2-enyl)-3-oxocyclopenten-1-yl]oxypentanal |
|---|---|
| PubChem CID | 137473684 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 4-methyl-2-[(4S)-2-(3-methylbutanoyl)-4-(3-methylbut-2-enyl)-3-oxocyclopenten-1-yl]oxypentanal |
| SMILES | CC(C)=CC[C@H]1CC(OC(C=O)CC(C)C)=C(C(=O)CC(C)C)C1=O |
| InChI | InChI=1S/C21H32O4/c1-13(2)7-8-16-11-19(25-17(12-22)9-14(3)4)20(21(16)24)18(23)10-15(5)6/h7,12,14-17H,8-11H2,1-6H3/t16-,17?/m0/s1 |
| InChIKey | DNWQCQRNHQOYCW-BHWOMJMDSA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|