C21H29BO4 — CID 156665828
CID 156665828 (PubChem CID 156665828) has the molecular formula C21H29BO4 and a molecular weight of 356.27 g/mol.
| Compound Name | CID 156665828 |
|---|---|
| PubChem CID | 156665828 |
| Molecular Formula | C21H29BO4 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | — |
| SMILES | [B]C1=C(CC=C(C)C)C(=O)[C@@](O)(CC=C(C)C)C(O)=C1C(=O)CC(C)C |
| InChI | InChI=1S/C21H29BO4/c1-12(2)7-8-15-18(22)17(16(23)11-14(5)6)20(25)21(26,19(15)24)10-9-13(3)4/h7,9,14,25-26H,8,10-11H2,1-6H3/t21-/m0/s1 |
| InChIKey | SDHWGPBICRJUBZ-NRFANRHFSA-N |
| XLogP | 3.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|