C31H46O6 — CID 162928854
(3S,3aR,5R,7S,7aS)-3,5',7-trihydroxy-3,7-dimethyl-4'-(3-methylbutanoyl)-2',2'-bis(3-methylbut-2-enyl)spiro[1,2,3a,4,6,7a-hexahydroindene-5,6'-cyclohex-4-ene]-1',3'-dione (PubChem CID 162928854) has the molecular formula C31H46O6 and a molecular weight of 514.70 g/mol. Its IUPAC name is (3S,3aR,5R,7S,7aS)-3,5',7-trihydroxy-3,7-dimethyl-4'-(3-methylbutanoyl)-2',2'-bis(3-methylbut-2-enyl)spiro[1,2,3a,4,6,7a-hexahydroindene-5,6'-cyclohex-4-ene]-1',3'-dione.
| Compound Name | (3S,3aR,5R,7S,7aS)-3,5',7-trihydroxy-3,7-dimethyl-4'-(3-methylbutanoyl)-2',2'-bis(3-methylbut-2-enyl)spiro[1,2,3a,4,6,7a-hexahydroindene-5,6'-cyclohex-4-ene]-1',3'-dione |
|---|---|
| PubChem CID | 162928854 |
| Molecular Formula | C31H46O6 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (3S,3aR,5R,7S,7aS)-3,5',7-trihydroxy-3,7-dimethyl-4'-(3-methylbutanoyl)-2',2'-bis(3-methylbut-2-enyl)spiro[1,2,3a,4,6,7a-hexahydroindene-5,6'-cyclohex-4-ene]-1',3'-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)C(C(=O)CC(C)C)=C(O)[C@]2(C[C@@H]3[C@H](CC[C@]3(C)O)[C@@](C)(O)C2)C1=O |
| InChI | InChI=1S/C31H46O6/c1-18(2)9-13-30(14-10-19(3)4)25(33)24(23(32)15-20(5)6)26(34)31(27(30)35)16-22-21(29(8,37)17-31)11-12-28(22,7)36/h9-10,20-22,34,36-37H,11-17H2,1-8H3/t21-,22+,28-,29-,31+/m0/s1 |
| InChIKey | MERSEXSZNNHAJK-UWXFRRLOSA-N |
| XLogP | 5.57 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|