C16H25ClO3 — CID 10828115
(3aR,4S,6aS)-3a-chloro-4,6a-dimethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one (PubChem CID 10828115) has the molecular formula C16H25ClO3 and a molecular weight of 300.83 g/mol. Its IUPAC name is (3aR,4S,6aS)-3a-chloro-4,6a-dimethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one.
| Compound Name | (3aR,4S,6aS)-3a-chloro-4,6a-dimethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one |
|---|---|
| PubChem CID | 10828115 |
| Molecular Formula | C16H25ClO3 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3aR,4S,6aS)-3a-chloro-4,6a-dimethyl-2,3-di(propan-2-yloxy)-5,6-dihydro-4H-pentalen-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(Cl)[C@@H](C)CC[C@@]2(C)C1=O |
| InChI | InChI=1S/C16H25ClO3/c1-9(2)19-12-13(18)15(6)8-7-11(5)16(15,17)14(12)20-10(3)4/h9-11H,7-8H2,1-6H3/t11-,15-,16-/m0/s1 |
| InChIKey | JGYCBKZPQHYDOP-UVBJJODRSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|