C20H29ClO3 — CID 11198987
(3aR,6aR,7aS)-3a-chloro-5,5,7a-trimethyl-2,3-di(propan-2-yloxy)-6a,7-dihydro-6H-cyclopenta[a]pentalen-1-one (PubChem CID 11198987) has the molecular formula C20H29ClO3 and a molecular weight of 352.90 g/mol. Its IUPAC name is (3aR,6aR,7aS)-3a-chloro-5,5,7a-trimethyl-2,3-di(propan-2-yloxy)-6a,7-dihydro-6H-cyclopenta[a]pentalen-1-one.
| Compound Name | (3aR,6aR,7aS)-3a-chloro-5,5,7a-trimethyl-2,3-di(propan-2-yloxy)-6a,7-dihydro-6H-cyclopenta[a]pentalen-1-one |
|---|---|
| PubChem CID | 11198987 |
| Molecular Formula | C20H29ClO3 |
| Molecular Weight | 352.90 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3aR,6aR,7aS)-3a-chloro-5,5,7a-trimethyl-2,3-di(propan-2-yloxy)-6a,7-dihydro-6H-cyclopenta[a]pentalen-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(Cl)C3=CC(C)(C)C[C@@H]3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C20H29ClO3/c1-11(2)23-15-16(22)19(7)9-13-8-18(5,6)10-14(13)20(19,21)17(15)24-12(3)4/h10-13H,8-9H2,1-7H3/t13-,19+,20+/m1/s1 |
| InChIKey | OEFGCQFORUFMLE-CWVNLOTRSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|