C10H13Cl2NO3S — CID 110789595
N-[2-(2,5-dichloro-4-methoxyphenyl)ethyl]methanesulfonamide (PubChem CID 110789595) has the molecular formula C10H13Cl2NO3S and a molecular weight of 298.19 g/mol. Its IUPAC name is N-[2-(2,5-dichloro-4-methoxyphenyl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2,5-dichloro-4-methoxyphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 110789595 |
| Molecular Formula | C10H13Cl2NO3S |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | N-[2-(2,5-dichloro-4-methoxyphenyl)ethyl]methanesulfonamide |
| SMILES | COc1cc(Cl)c(CCNS(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C10H13Cl2NO3S/c1-16-10-6-8(11)7(5-9(10)12)3-4-13-17(2,14)15/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | JUTPGGAFPIGOFB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |