C13H22N2O4S2 — CID 110790785
1-[2-(dimethylsulfamoylamino)ethyl]-4-propan-2-ylsulfonylbenzene (PubChem CID 110790785) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[2-(dimethylsulfamoylamino)ethyl]-4-propan-2-ylsulfonylbenzene.
| Compound Name | 1-[2-(dimethylsulfamoylamino)ethyl]-4-propan-2-ylsulfonylbenzene |
|---|---|
| PubChem CID | 110790785 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[2-(dimethylsulfamoylamino)ethyl]-4-propan-2-ylsulfonylbenzene |
| SMILES | CC(C)S(=O)(=O)c1ccc(CCNS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-11(2)20(16,17)13-7-5-12(6-8-13)9-10-14-21(18,19)15(3)4/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | GVXXHFAZZGJFQG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |