C17H28N2O3S — CID 110776126
1-(2,2-dimethylpropyl)-3-[2-(4-propan-2-ylsulfonylphenyl)ethyl]urea (PubChem CID 110776126) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[2-(4-propan-2-ylsulfonylphenyl)ethyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[2-(4-propan-2-ylsulfonylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 110776126 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[2-(4-propan-2-ylsulfonylphenyl)ethyl]urea |
| SMILES | CC(C)S(=O)(=O)c1ccc(CCNC(=O)NCC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-13(2)23(21,22)15-8-6-14(7-9-15)10-11-18-16(20)19-12-17(3,4)5/h6-9,13H,10-12H2,1-5H3,(H2,18,19,20) |
| InChIKey | IZCYVSJESCHUNZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |