C15H24N2OS — CID 110776095
1-(2,2-dimethylpropyl)-3-[2-(4-methylsulfanylphenyl)ethyl]urea (PubChem CID 110776095) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[2-(4-methylsulfanylphenyl)ethyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[2-(4-methylsulfanylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 110776095 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[2-(4-methylsulfanylphenyl)ethyl]urea |
| SMILES | CSc1ccc(CCNC(=O)NCC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24N2OS/c1-15(2,3)11-17-14(18)16-10-9-12-5-7-13(19-4)8-6-12/h5-8H,9-11H2,1-4H3,(H2,16,17,18) |
| InChIKey | CFAICGZOIIQTPH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |