C19H22N2O3 — CID 110792701
3-acetamido-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]benzamide (PubChem CID 110792701) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-acetamido-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]benzamide.
| Compound Name | 3-acetamido-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]benzamide |
|---|---|
| PubChem CID | 110792701 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-acetamido-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]benzamide |
| SMILES | CC(=O)Nc1cccc(C(=O)Nc2ccc(OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-13(22)20-16-7-5-6-14(12-16)18(23)21-15-8-10-17(11-9-15)24-19(2,3)4/h5-12H,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | KAJLVKSEAJDTME-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |