C20H23N3O2 — CID 110794764
N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-4-phenoxybutanamide (PubChem CID 110794764) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-4-phenoxybutanamide.
| Compound Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110794764 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1,2-dimethylbenzimidazol-5-yl)methyl]-4-phenoxybutanamide |
| SMILES | Cc1nc2cc(CNC(=O)CCCOc3ccccc3)ccc2n1C |
| InChI | InChI=1S/C20H23N3O2/c1-15-22-18-13-16(10-11-19(18)23(15)2)14-21-20(24)9-6-12-25-17-7-4-3-5-8-17/h3-5,7-8,10-11,13H,6,9,12,14H2,1-2H3,(H,21,24) |
| InChIKey | XKNHEJMXFJRZQS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|