C18H17N3O4 — CID 110796279
N-[2-oxo-2-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethylamino]ethyl]benzamide (PubChem CID 110796279) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[2-oxo-2-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethylamino]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 110796279 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[2-oxo-2-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethylamino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NCCc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C18H17N3O4/c22-16(11-20-17(23)13-4-2-1-3-5-13)19-9-8-12-6-7-14-15(10-12)25-18(24)21-14/h1-7,10H,8-9,11H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | FZFZWLPLEIPYAD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |