C16H12ClFN2O3 — CID 110792066
2-chloro-6-fluoro-N-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]benzamide (PubChem CID 110792066) has the molecular formula C16H12ClFN2O3 and a molecular weight of 334.73 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110792066 |
| Molecular Formula | C16H12ClFN2O3 |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-chloro-6-fluoro-N-[2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc2[nH]c(=O)oc2c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H12ClFN2O3/c17-10-2-1-3-11(18)14(10)15(21)19-7-6-9-4-5-12-13(8-9)23-16(22)20-12/h1-5,8H,6-7H2,(H,19,21)(H,20,22) |
| InChIKey | BTRPXBXGVHCEPF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |