C13H12ClFN2O2 — CID 90537631
2-chloro-6-fluoro-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]benzamide (PubChem CID 90537631) has the molecular formula C13H12ClFN2O2 and a molecular weight of 282.70 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90537631 |
| Molecular Formula | C13H12ClFN2O2 |
| Molecular Weight | 282.70 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-chloro-6-fluoro-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]benzamide |
| SMILES | Cc1cc(CCNC(=O)c2c(F)cccc2Cl)on1 |
| InChI | InChI=1S/C13H12ClFN2O2/c1-8-7-9(19-17-8)5-6-16-13(18)12-10(14)3-2-4-11(12)15/h2-4,7H,5-6H2,1H3,(H,16,18) |
| InChIKey | HXOSCWUFDFUHMW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |