C10H14N4O2 — CID 115261171
6-[2-(hydrazinylmethylamino)ethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 115261171) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-[2-(hydrazinylmethylamino)ethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(hydrazinylmethylamino)ethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115261171 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6-[2-(hydrazinylmethylamino)ethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | NNCNCCc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H14N4O2/c11-13-6-12-4-3-7-1-2-8-9(5-7)16-10(15)14-8/h1-2,5,12-13H,3-4,6,11H2,(H,14,15) |
| InChIKey | MRLWIEJMVDOYKG-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|